C32H32Cl2N6O3S — CID 142695836
2-[5-(3,4-dichlorophenyl)sulfonyl-6H-phenanthridin-6-yl]-N-[3-(4-pyrimidin-4-ylpiperazin-1-yl)propyl]acetamide (PubChem CID 142695836) has the molecular formula C32H32Cl2N6O3S and a molecular weight of 651.62 g/mol. Its IUPAC name is 2-[5-(3,4-dichlorophenyl)sulfonyl-6H-phenanthridin-6-yl]-N-[3-(4-pyrimidin-4-ylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-[5-(3,4-dichlorophenyl)sulfonyl-6H-phenanthridin-6-yl]-N-[3-(4-pyrimidin-4-ylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 142695836 |
| Molecular Formula | C32H32Cl2N6O3S |
| Molecular Weight | 651.62 g/mol |
| Exact Mass | 650.16 |
| IUPAC Name | 2-[5-(3,4-dichlorophenyl)sulfonyl-6H-phenanthridin-6-yl]-N-[3-(4-pyrimidin-4-ylpiperazin-1-yl)propyl]acetamide |
| SMILES | O=C(CC1c2ccccc2-c2ccccc2N1S(=O)(=O)c1ccc(Cl)c(Cl)c1)NCCCN1CCN(c2ccncn2)CC1 |
| InChI | InChI=1S/C32H32Cl2N6O3S/c33-27-11-10-23(20-28(27)34)44(42,43)40-29-9-4-3-7-25(29)24-6-1-2-8-26(24)30(40)21-32(41)36-13-5-15-38-16-18-39(19-17-38)31-12-14-35-22-37-31/h1-4,6-12,14,20,22,30H,5,13,15-19,21H2,(H,36,41) |
| InChIKey | GGMANUOJUOQVQZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|