C22H22ClNO5S — CID 102266899
methyl 2-[(1R,3R)-6-chloro-2-(4-methylphenyl)sulfonyl-3-(3-oxobut-1-en-2-yl)-1,3-dihydroisoindol-1-yl]acetate (PubChem CID 102266899) has the molecular formula C22H22ClNO5S and a molecular weight of 447.94 g/mol. Its IUPAC name is methyl 2-[(1R,3R)-6-chloro-2-(4-methylphenyl)sulfonyl-3-(3-oxobut-1-en-2-yl)-1,3-dihydroisoindol-1-yl]acetate.
| Compound Name | methyl 2-[(1R,3R)-6-chloro-2-(4-methylphenyl)sulfonyl-3-(3-oxobut-1-en-2-yl)-1,3-dihydroisoindol-1-yl]acetate |
|---|---|
| PubChem CID | 102266899 |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | methyl 2-[(1R,3R)-6-chloro-2-(4-methylphenyl)sulfonyl-3-(3-oxobut-1-en-2-yl)-1,3-dihydroisoindol-1-yl]acetate |
| SMILES | C=C(C(C)=O)[C@H]1c2ccc(Cl)cc2[C@@H](CC(=O)OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H22ClNO5S/c1-13-5-8-17(9-6-13)30(27,28)24-20(12-21(26)29-4)19-11-16(23)7-10-18(19)22(24)14(2)15(3)25/h5-11,20,22H,2,12H2,1,3-4H3/t20-,22+/m1/s1 |
| InChIKey | WTKXWLMORRHCRX-IRLDBZIGSA-N |
| XLogP | 4.14 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|