C18H28INO2S — CID 23244311
(2R,3S,5S)-5-ethyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-pentylpyrrolidine (PubChem CID 23244311) has the molecular formula C18H28INO2S and a molecular weight of 449.40 g/mol. Its IUPAC name is (2R,3S,5S)-5-ethyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-pentylpyrrolidine.
| Compound Name | (2R,3S,5S)-5-ethyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-pentylpyrrolidine |
|---|---|
| PubChem CID | 23244311 |
| Molecular Formula | C18H28INO2S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (2R,3S,5S)-5-ethyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-pentylpyrrolidine |
| SMILES | CCCCC[C@@H]1[C@@H](I)C[C@H](CC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H28INO2S/c1-4-6-7-8-18-17(19)13-15(5-2)20(18)23(21,22)16-11-9-14(3)10-12-16/h9-12,15,17-18H,4-8,13H2,1-3H3/t15-,17-,18+/m0/s1 |
| InChIKey | IFRIXDXIVDZDCV-RYQLBKOJSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|