C21H26INO2S — CID 101112181
(2R,3S,5R)-5-butyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine (PubChem CID 101112181) has the molecular formula C21H26INO2S and a molecular weight of 483.42 g/mol. Its IUPAC name is (2R,3S,5R)-5-butyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine.
| Compound Name | (2R,3S,5R)-5-butyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 101112181 |
| Molecular Formula | C21H26INO2S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | (2R,3S,5R)-5-butyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine |
| SMILES | CCCC[C@@H]1C[C@H](I)[C@@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H26INO2S/c1-3-4-10-18-15-20(22)21(17-8-6-5-7-9-17)23(18)26(24,25)19-13-11-16(2)12-14-19/h5-9,11-14,18,20-21H,3-4,10,15H2,1-2H3/t18-,20+,21-/m1/s1 |
| InChIKey | UDIQRKXEGFIADU-HLAWJBBLSA-N |
| XLogP | 5.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|