C16H20O6S — CID 102216505
1-O-methyl 3-O-[(Z)-pent-2-enyl] 2-(4-methylphenyl)sulfonylpropanedioate (PubChem CID 102216505) has the molecular formula C16H20O6S and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-O-methyl 3-O-[(Z)-pent-2-enyl] 2-(4-methylphenyl)sulfonylpropanedioate.
| Compound Name | 1-O-methyl 3-O-[(Z)-pent-2-enyl] 2-(4-methylphenyl)sulfonylpropanedioate |
|---|---|
| PubChem CID | 102216505 |
| Molecular Formula | C16H20O6S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-O-methyl 3-O-[(Z)-pent-2-enyl] 2-(4-methylphenyl)sulfonylpropanedioate |
| SMILES | CC/C=C\COC(=O)C(C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20O6S/c1-4-5-6-11-22-16(18)14(15(17)21-3)23(19,20)13-9-7-12(2)8-10-13/h5-10,14H,4,11H2,1-3H3/b6-5- |
| InChIKey | RGEDNTMAJMAVAE-WAYWQWQTSA-N |
| XLogP | 1.82 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|