C25H26O6S — CID 102473262
1-O-(cyclohexen-1-yl) 3-O-[(E)-3-phenylprop-2-enyl] 2-(4-methylphenyl)sulfonylpropanedioate (PubChem CID 102473262) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is 1-O-(cyclohexen-1-yl) 3-O-[(E)-3-phenylprop-2-enyl] 2-(4-methylphenyl)sulfonylpropanedioate.
| Compound Name | 1-O-(cyclohexen-1-yl) 3-O-[(E)-3-phenylprop-2-enyl] 2-(4-methylphenyl)sulfonylpropanedioate |
|---|---|
| PubChem CID | 102473262 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1-O-(cyclohexen-1-yl) 3-O-[(E)-3-phenylprop-2-enyl] 2-(4-methylphenyl)sulfonylpropanedioate |
| SMILES | Cc1ccc(S(=O)(=O)C(C(=O)OC/C=C/c2ccccc2)C(=O)OC2=CCCCC2)cc1 |
| InChI | InChI=1S/C25H26O6S/c1-19-14-16-22(17-15-19)32(28,29)23(25(27)31-21-12-6-3-7-13-21)24(26)30-18-8-11-20-9-4-2-5-10-20/h2,4-5,8-12,14-17,23H,3,6-7,13,18H2,1H3/b11-8+ |
| InChIKey | DURBNCQWSOJOIQ-DHZHZOJOSA-N |
| XLogP | 4.40 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|