C21H26O6SSi — CID 101435767
1-O-prop-2-enyl 3-O-[(E)-5-trimethylsilylpent-2-en-4-ynyl] 2-(4-methylphenyl)sulfonylpropanedioate (PubChem CID 101435767) has the molecular formula C21H26O6SSi and a molecular weight of 434.59 g/mol. Its IUPAC name is 1-O-prop-2-enyl 3-O-[(E)-5-trimethylsilylpent-2-en-4-ynyl] 2-(4-methylphenyl)sulfonylpropanedioate.
| Compound Name | 1-O-prop-2-enyl 3-O-[(E)-5-trimethylsilylpent-2-en-4-ynyl] 2-(4-methylphenyl)sulfonylpropanedioate |
|---|---|
| PubChem CID | 101435767 |
| Molecular Formula | C21H26O6SSi |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-O-prop-2-enyl 3-O-[(E)-5-trimethylsilylpent-2-en-4-ynyl] 2-(4-methylphenyl)sulfonylpropanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OC/C=C/C#C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H26O6SSi/c1-6-14-26-20(22)19(28(24,25)18-12-10-17(2)11-13-18)21(23)27-15-8-7-9-16-29(3,4)5/h6-8,10-13,19H,1,14-15H2,2-5H3/b8-7+ |
| InChIKey | LIFLTTYVUAMNRC-BQYQJAHWSA-N |
| XLogP | 2.85 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|