C17H18O4S2 — CID 86092895
thiophen-2-ylmethyl 2-(4-methylphenyl)sulfonylpent-4-enoate (PubChem CID 86092895) has the molecular formula C17H18O4S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is thiophen-2-ylmethyl 2-(4-methylphenyl)sulfonylpent-4-enoate.
| Compound Name | thiophen-2-ylmethyl 2-(4-methylphenyl)sulfonylpent-4-enoate |
|---|---|
| PubChem CID | 86092895 |
| Molecular Formula | C17H18O4S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | thiophen-2-ylmethyl 2-(4-methylphenyl)sulfonylpent-4-enoate |
| SMILES | C=CCC(C(=O)OCc1cccs1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18O4S2/c1-3-5-16(17(18)21-12-14-6-4-11-22-14)23(19,20)15-9-7-13(2)8-10-15/h3-4,6-11,16H,1,5,12H2,2H3 |
| InChIKey | WNWAFMARJUDJBK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|