C22H28O4S — CID 23047896
ethyl 2-(4-methylphenyl)sulfonyl-5-phenylheptanoate (PubChem CID 23047896) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is ethyl 2-(4-methylphenyl)sulfonyl-5-phenylheptanoate.
| Compound Name | ethyl 2-(4-methylphenyl)sulfonyl-5-phenylheptanoate |
|---|---|
| PubChem CID | 23047896 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | ethyl 2-(4-methylphenyl)sulfonyl-5-phenylheptanoate |
| SMILES | CCOC(=O)C(CCC(CC)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H28O4S/c1-4-18(19-9-7-6-8-10-19)13-16-21(22(23)26-5-2)27(24,25)20-14-11-17(3)12-15-20/h6-12,14-15,18,21H,4-5,13,16H2,1-3H3 |
| InChIKey | NHTKEIRDRYMIKE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |