About thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate
thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate (PubChem CID 10518922) has the molecular formula C14H13ClN2O2S
and a molecular weight of 308.79 g/mol. Its IUPAC name is thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate.
Molecular Properties
| Compound Name | thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate |
| PubChem CID | 10518922 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate |
| SMILES | Cc1ccc(N/N=C(\Cl)C(=O)OCc2cccs2)cc1 |
| InChI | InChI=1S/C14H13ClN2O2S/c1-10-4-6-11(7-5-10)16-17-13(15)14(18)19-9-12-3-2-8-20-12/h2-8,16H,9H2,1H3/b17-13- |
| InChIKey | LVDUZJVZOKVGIZ-LGMDPLHJSA-N |
| XLogP | 3.76 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate?
The IUPAC name of thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate (CID 10518922) is thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate.
What is the SMILES notation for thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate?
The canonical SMILES for thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate is Cc1ccc(N/N=C(\Cl)C(=O)OCc2cccs2)cc1.
What is the InChIKey of thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate?
The InChIKey is LVDUZJVZOKVGIZ-LGMDPLHJSA-N. The full InChI is InChI=1S/C14H13ClN2O2S/c1-10-4-6-11(7-5-10)16-17-13(15)14(18)19-9-12-3-2-8-20-12/h2-8,16H,9H2,1H3/b17-13-.
What are the key properties of thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate?
thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate has a molecular weight of 308.79 g/mol, XLogP of 3.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate is sourced from PubChem (CID 10518922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).