C17H24O2S2 — CID 21353108
1-methyl-4-[(3E,6E)-1-methylsulfanylnona-3,6-dienyl]sulfonylbenzene (PubChem CID 21353108) has the molecular formula C17H24O2S2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-methyl-4-[(3E,6E)-1-methylsulfanylnona-3,6-dienyl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(3E,6E)-1-methylsulfanylnona-3,6-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 21353108 |
| Molecular Formula | C17H24O2S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-methyl-4-[(3E,6E)-1-methylsulfanylnona-3,6-dienyl]sulfonylbenzene |
| SMILES | CC/C=C/C/C=C/CC(SC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O2S2/c1-4-5-6-7-8-9-10-17(20-3)21(18,19)16-13-11-15(2)12-14-16/h5-6,8-9,11-14,17H,4,7,10H2,1-3H3/b6-5+,9-8+ |
| InChIKey | OGUJSUNIWPUYBQ-HHWLVVFRSA-N |
| XLogP | 4.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|