C22H24O7S — CID 100989892
[2-[(2R,3S)-3-acetyloxy-2-[(4-methylphenyl)sulfonylmethyl]butanoyl]phenyl] acetate (PubChem CID 100989892) has the molecular formula C22H24O7S and a molecular weight of 432.49 g/mol. Its IUPAC name is [2-[(2R,3S)-3-acetyloxy-2-[(4-methylphenyl)sulfonylmethyl]butanoyl]phenyl] acetate.
| Compound Name | [2-[(2R,3S)-3-acetyloxy-2-[(4-methylphenyl)sulfonylmethyl]butanoyl]phenyl] acetate |
|---|---|
| PubChem CID | 100989892 |
| Molecular Formula | C22H24O7S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [2-[(2R,3S)-3-acetyloxy-2-[(4-methylphenyl)sulfonylmethyl]butanoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)[C@H](CS(=O)(=O)c1ccc(C)cc1)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C22H24O7S/c1-14-9-11-18(12-10-14)30(26,27)13-20(15(2)28-16(3)23)22(25)19-7-5-6-8-21(19)29-17(4)24/h5-12,15,20H,13H2,1-4H3/t15-,20+/m0/s1 |
| InChIKey | ZPEOAHNVUODJLJ-MGPUTAFESA-N |
| XLogP | 3.14 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|