C18H23FO5S2 — CID 139752776
[(2-fluorophenyl)methyl-bis(2-hydroxyethyl)-λ4-sulfanyl] 4-methylbenzenesulfonate (PubChem CID 139752776) has the molecular formula C18H23FO5S2 and a molecular weight of 402.51 g/mol. Its IUPAC name is [(2-fluorophenyl)methyl-bis(2-hydroxyethyl)-λ4-sulfanyl] 4-methylbenzenesulfonate.
| Compound Name | [(2-fluorophenyl)methyl-bis(2-hydroxyethyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139752776 |
| Molecular Formula | C18H23FO5S2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [(2-fluorophenyl)methyl-bis(2-hydroxyethyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OS(CCO)(CCO)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H23FO5S2/c1-15-6-8-17(9-7-15)26(22,23)24-25(12-10-20,13-11-21)14-16-4-2-3-5-18(16)19/h2-9,20-21H,10-14H2,1H3 |
| InChIKey | MKHZCPBQFNQUFD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |