C33H31NO4P2 — CID 90416450
1,3-bis(diphenylphosphoryloxy)-1-phenylpropan-2-amine (PubChem CID 90416450) has the molecular formula C33H31NO4P2 and a molecular weight of 567.56 g/mol. Its IUPAC name is 1,3-bis(diphenylphosphoryloxy)-1-phenylpropan-2-amine.
| Compound Name | 1,3-bis(diphenylphosphoryloxy)-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 90416450 |
| Molecular Formula | C33H31NO4P2 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 1,3-bis(diphenylphosphoryloxy)-1-phenylpropan-2-amine |
| SMILES | NC(COP(=O)(c1ccccc1)c1ccccc1)C(OP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31NO4P2/c34-32(26-37-39(35,28-18-8-2-9-19-28)29-20-10-3-11-21-29)33(27-16-6-1-7-17-27)38-40(36,30-22-12-4-13-23-30)31-24-14-5-15-25-31/h1-25,32-33H,26,34H2 |
| InChIKey | QCYNFWLNKBZQAV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|