C36H31O5P — CID 11399001
[(1S,2S)-2-diphenylphosphoryloxy-5-oxo-1,5-diphenylpentyl] benzoate (PubChem CID 11399001) has the molecular formula C36H31O5P and a molecular weight of 574.61 g/mol. Its IUPAC name is [(1S,2S)-2-diphenylphosphoryloxy-5-oxo-1,5-diphenylpentyl] benzoate.
| Compound Name | [(1S,2S)-2-diphenylphosphoryloxy-5-oxo-1,5-diphenylpentyl] benzoate |
|---|---|
| PubChem CID | 11399001 |
| Molecular Formula | C36H31O5P |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | [(1S,2S)-2-diphenylphosphoryloxy-5-oxo-1,5-diphenylpentyl] benzoate |
| SMILES | O=C(CC[C@H](OP(=O)(c1ccccc1)c1ccccc1)[C@@H](OC(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H31O5P/c37-33(28-16-6-1-7-17-28)26-27-34(41-42(39,31-22-12-4-13-23-31)32-24-14-5-15-25-32)35(29-18-8-2-9-19-29)40-36(38)30-20-10-3-11-21-30/h1-25,34-35H,26-27H2/t34-,35-/m0/s1 |
| InChIKey | CXQIKNGAGWGLME-PXLJZGITSA-N |
| XLogP | 7.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|