C26H26F3O4P — CID 90416303
(5-diphenylphosphoryloxy-1,1,1-trifluoro-4-methylhexan-3-yl) benzoate (PubChem CID 90416303) has the molecular formula C26H26F3O4P and a molecular weight of 490.46 g/mol. Its IUPAC name is (5-diphenylphosphoryloxy-1,1,1-trifluoro-4-methylhexan-3-yl) benzoate.
| Compound Name | (5-diphenylphosphoryloxy-1,1,1-trifluoro-4-methylhexan-3-yl) benzoate |
|---|---|
| PubChem CID | 90416303 |
| Molecular Formula | C26H26F3O4P |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (5-diphenylphosphoryloxy-1,1,1-trifluoro-4-methylhexan-3-yl) benzoate |
| SMILES | CC(OP(=O)(c1ccccc1)c1ccccc1)C(C)C(CC(F)(F)F)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26F3O4P/c1-19(24(18-26(27,28)29)32-25(30)21-12-6-3-7-13-21)20(2)33-34(31,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,19-20,24H,18H2,1-2H3 |
| InChIKey | FSMTVOPTOVXWFR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|