C18H18NO6P — CID 68774346
(3S)-3-amino-6-diphenylphosphoryloxy-4,5-dioxohexanoic acid (PubChem CID 68774346) has the molecular formula C18H18NO6P and a molecular weight of 375.32 g/mol. Its IUPAC name is (3S)-3-amino-6-diphenylphosphoryloxy-4,5-dioxohexanoic acid.
| Compound Name | (3S)-3-amino-6-diphenylphosphoryloxy-4,5-dioxohexanoic acid |
|---|---|
| PubChem CID | 68774346 |
| Molecular Formula | C18H18NO6P |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (3S)-3-amino-6-diphenylphosphoryloxy-4,5-dioxohexanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)C(=O)COP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18NO6P/c19-15(11-17(21)22)18(23)16(20)12-25-26(24,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12,19H2,(H,21,22)/t15-/m0/s1 |
| InChIKey | OJJZHFSPCUSEBH-HNNXBMFYSA-N |
| XLogP | 0.87 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|