C12H20O6P2 — CID 87905295
butan-2-yloxy-[1-hydroxy-1-[hydroxy(phenyl)phosphoryl]ethyl]phosphinic acid (PubChem CID 87905295) has the molecular formula C12H20O6P2 and a molecular weight of 322.23 g/mol. Its IUPAC name is butan-2-yloxy-[1-hydroxy-1-[hydroxy(phenyl)phosphoryl]ethyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[1-hydroxy-1-[hydroxy(phenyl)phosphoryl]ethyl]phosphinic acid |
|---|---|
| PubChem CID | 87905295 |
| Molecular Formula | C12H20O6P2 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | butan-2-yloxy-[1-hydroxy-1-[hydroxy(phenyl)phosphoryl]ethyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(C)(O)P(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C12H20O6P2/c1-4-10(2)18-20(16,17)12(3,13)19(14,15)11-8-6-5-7-9-11/h5-10,13H,4H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | RTKCAMFJJWBFIY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|