C24H33O4PSi — CID 173322636
butan-2-yloxy-[4-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]phosphinic acid (PubChem CID 173322636) has the molecular formula C24H33O4PSi and a molecular weight of 444.58 g/mol. Its IUPAC name is butan-2-yloxy-[4-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[4-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]phosphinic acid |
|---|---|
| PubChem CID | 173322636 |
| Molecular Formula | C24H33O4PSi |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | butan-2-yloxy-[4-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C=CC=CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H33O4PSi/c1-6-21(2)28-29(25,26)20-14-13-19-27-30(24(3,4)5,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-21H,6H2,1-5H3,(H,25,26) |
| InChIKey | CDFJMBXLTXPAHI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|