C20H25O4PSi — CID 23194391
[(1E,3E)-4-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]phosphonic acid (PubChem CID 23194391) has the molecular formula C20H25O4PSi and a molecular weight of 388.48 g/mol. Its IUPAC name is [(1E,3E)-4-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]phosphonic acid.
| Compound Name | [(1E,3E)-4-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 23194391 |
| Molecular Formula | C20H25O4PSi |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(1E,3E)-4-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]phosphonic acid |
| SMILES | CC(C)(C)[Si](O/C=C/C=C/P(=O)(O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25O4PSi/c1-20(2,3)26(18-12-6-4-7-13-18,19-14-8-5-9-15-19)24-16-10-11-17-25(21,22)23/h4-17H,1-3H3,(H2,21,22,23)/b16-10+,17-11+ |
| InChIKey | QGTGJYCRJKWCJU-OTYYAQKOSA-N |
| XLogP | 3.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|