C14H20O2Si — CID 102468198
[(1E)-buta-1,3-dienoxy]-tert-butyl-hydroxy-phenylsilane (PubChem CID 102468198) has the molecular formula C14H20O2Si and a molecular weight of 248.40 g/mol. Its IUPAC name is [(1E)-buta-1,3-dienoxy]-tert-butyl-hydroxy-phenylsilane.
| Compound Name | [(1E)-buta-1,3-dienoxy]-tert-butyl-hydroxy-phenylsilane |
|---|---|
| PubChem CID | 102468198 |
| Molecular Formula | C14H20O2Si |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [(1E)-buta-1,3-dienoxy]-tert-butyl-hydroxy-phenylsilane |
| SMILES | C=C/C=C/O[Si@@](O)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C14H20O2Si/c1-5-6-12-16-17(15,14(2,3)4)13-10-8-7-9-11-13/h5-12,15H,1H2,2-4H3/b12-6+/t17-/m0/s1 |
| InChIKey | GPPZYFGIDUBHSU-NIUUYTMRSA-N |
| XLogP | 2.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|