C20H25NO4Si — CID 10970722
2-[(Z)-2-[(1E)-buta-1,3-dienoxy]-2-[tert-butyl(dimethyl)silyl]oxyethenyl]isoindole-1,3-dione (PubChem CID 10970722) has the molecular formula C20H25NO4Si and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[(Z)-2-[(1E)-buta-1,3-dienoxy]-2-[tert-butyl(dimethyl)silyl]oxyethenyl]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-2-[(1E)-buta-1,3-dienoxy]-2-[tert-butyl(dimethyl)silyl]oxyethenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10970722 |
| Molecular Formula | C20H25NO4Si |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-[(Z)-2-[(1E)-buta-1,3-dienoxy]-2-[tert-butyl(dimethyl)silyl]oxyethenyl]isoindole-1,3-dione |
| SMILES | C=C/C=C/O/C(=C/N1C(=O)c2ccccc2C1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H25NO4Si/c1-7-8-13-24-17(25-26(5,6)20(2,3)4)14-21-18(22)15-11-9-10-12-16(15)19(21)23/h7-14H,1H2,2-6H3/b13-8+,17-14- |
| InChIKey | YRIDSUICJJZOAH-SXWMIQJBSA-N |
| XLogP | 4.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|