C13H9NO5 — CID 139036666
methyl (Z)-3-(1,3-dioxoisoindol-2-yl)-2-formylprop-2-enoate (PubChem CID 139036666) has the molecular formula C13H9NO5 and a molecular weight of 259.22 g/mol. Its IUPAC name is methyl (Z)-3-(1,3-dioxoisoindol-2-yl)-2-formylprop-2-enoate.
| Compound Name | methyl (Z)-3-(1,3-dioxoisoindol-2-yl)-2-formylprop-2-enoate |
|---|---|
| PubChem CID | 139036666 |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | methyl (Z)-3-(1,3-dioxoisoindol-2-yl)-2-formylprop-2-enoate |
| SMILES | COC(=O)/C(C=O)=C\N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H9NO5/c1-19-13(18)8(7-15)6-14-11(16)9-4-2-3-5-10(9)12(14)17/h2-7H,1H3/b8-6- |
| InChIKey | OSKRSSACXKGWJK-VURMDHGXSA-N |
| XLogP | 0.54 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|