C13H20F2NO3P — CID 87136258
butan-2-yloxy-[[3-(ethylamino)phenyl]-difluoromethyl]phosphinic acid (PubChem CID 87136258) has the molecular formula C13H20F2NO3P and a molecular weight of 307.28 g/mol. Its IUPAC name is butan-2-yloxy-[[3-(ethylamino)phenyl]-difluoromethyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[[3-(ethylamino)phenyl]-difluoromethyl]phosphinic acid |
|---|---|
| PubChem CID | 87136258 |
| Molecular Formula | C13H20F2NO3P |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | butan-2-yloxy-[[3-(ethylamino)phenyl]-difluoromethyl]phosphinic acid |
| SMILES | CCNc1cccc(C(F)(F)P(=O)(O)OC(C)CC)c1 |
| InChI | InChI=1S/C13H20F2NO3P/c1-4-10(3)19-20(17,18)13(14,15)11-7-6-8-12(9-11)16-5-2/h6-10,16H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | WUXYQRFLEGPUBY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|