C13H27N2O2P — CID 170850650
[3,3-dimethylbutan-2-yloxy-[propan-2-yl(propyl)amino]phosphoryl]formonitrile (PubChem CID 170850650) has the molecular formula C13H27N2O2P and a molecular weight of 274.34 g/mol. Its IUPAC name is [3,3-dimethylbutan-2-yloxy-[propan-2-yl(propyl)amino]phosphoryl]formonitrile.
| Compound Name | [3,3-dimethylbutan-2-yloxy-[propan-2-yl(propyl)amino]phosphoryl]formonitrile |
|---|---|
| PubChem CID | 170850650 |
| Molecular Formula | C13H27N2O2P |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [3,3-dimethylbutan-2-yloxy-[propan-2-yl(propyl)amino]phosphoryl]formonitrile |
| SMILES | CCCN(C(C)C)P(=O)(C#N)OC(C)C(C)(C)C |
| InChI | InChI=1S/C13H27N2O2P/c1-8-9-15(11(2)3)18(16,10-14)17-12(4)13(5,6)7/h11-12H,8-9H2,1-7H3 |
| InChIKey | ZWIDCDQEVGKRNM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|