C22H49N — CID 160564373
2,3-dimethylpentane;N-ethyl-N-propyldecan-1-amine (PubChem CID 160564373) has the molecular formula C22H49N and a molecular weight of 327.64 g/mol. Its IUPAC name is 2,3-dimethylpentane;N-ethyl-N-propyldecan-1-amine.
| Compound Name | 2,3-dimethylpentane;N-ethyl-N-propyldecan-1-amine |
|---|---|
| PubChem CID | 160564373 |
| Molecular Formula | C22H49N |
| Molecular Weight | 327.64 g/mol |
| Exact Mass | 327.39 |
| IUPAC Name | 2,3-dimethylpentane;N-ethyl-N-propyldecan-1-amine |
| SMILES | CCC(C)C(C)C.CCCCCCCCCCN(CC)CCC |
| InChI | InChI=1S/C15H33N.C7H16/c1-4-7-8-9-10-11-12-13-15-16(6-3)14-5-2;1-5-7(4)6(2)3/h4-15H2,1-3H3;6-7H,5H2,1-4H3 |
| InChIKey | QZSPTARCLWMHPT-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|