C14H29N2O2P — CID 170850706
[2,4-dimethylpentan-3-yloxy-(dipropylamino)phosphoryl]formonitrile (PubChem CID 170850706) has the molecular formula C14H29N2O2P and a molecular weight of 288.37 g/mol. Its IUPAC name is [2,4-dimethylpentan-3-yloxy-(dipropylamino)phosphoryl]formonitrile.
| Compound Name | [2,4-dimethylpentan-3-yloxy-(dipropylamino)phosphoryl]formonitrile |
|---|---|
| PubChem CID | 170850706 |
| Molecular Formula | C14H29N2O2P |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [2,4-dimethylpentan-3-yloxy-(dipropylamino)phosphoryl]formonitrile |
| SMILES | CCCN(CCC)P(=O)(C#N)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C14H29N2O2P/c1-7-9-16(10-8-2)19(17,11-15)18-14(12(3)4)13(5)6/h12-14H,7-10H2,1-6H3 |
| InChIKey | GQBJRUZARNWPTH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|