C18H37O4P — CID 87699359
1-[bis(2,4-dimethylpentan-3-yloxy)phosphoryl]butan-1-one (PubChem CID 87699359) has the molecular formula C18H37O4P and a molecular weight of 348.46 g/mol. Its IUPAC name is 1-[bis(2,4-dimethylpentan-3-yloxy)phosphoryl]butan-1-one.
| Compound Name | 1-[bis(2,4-dimethylpentan-3-yloxy)phosphoryl]butan-1-one |
|---|---|
| PubChem CID | 87699359 |
| Molecular Formula | C18H37O4P |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1-[bis(2,4-dimethylpentan-3-yloxy)phosphoryl]butan-1-one |
| SMILES | CCCC(=O)P(=O)(OC(C(C)C)C(C)C)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C18H37O4P/c1-10-11-16(19)23(20,21-17(12(2)3)13(4)5)22-18(14(6)7)15(8)9/h12-15,17-18H,10-11H2,1-9H3 |
| InChIKey | BEQMKKYPWKDWHW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|