C7H16ClO2P — CID 129373323
(3R)-3-[chloro(methyl)phosphoryl]oxy-2,2-dimethylbutane (PubChem CID 129373323) has the molecular formula C7H16ClO2P and a molecular weight of 198.63 g/mol. Its IUPAC name is (3R)-3-[chloro(methyl)phosphoryl]oxy-2,2-dimethylbutane.
| Compound Name | (3R)-3-[chloro(methyl)phosphoryl]oxy-2,2-dimethylbutane |
|---|---|
| PubChem CID | 129373323 |
| Molecular Formula | C7H16ClO2P |
| Molecular Weight | 198.63 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (3R)-3-[chloro(methyl)phosphoryl]oxy-2,2-dimethylbutane |
| SMILES | C[C@@H](O[P@@](C)(=O)Cl)C(C)(C)C |
| InChI | InChI=1S/C7H16ClO2P/c1-6(7(2,3)4)10-11(5,8)9/h6H,1-5H3/t6-,11-/m1/s1 |
| InChIKey | XVNBZVNXJMOQEX-KSBSHMNSSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|