C19H28FN2O2P — CID 174920168
4-(4-aminophenyl)aniline;3-[fluoro(methyl)phosphoryl]oxy-2,2-dimethylbutane (PubChem CID 174920168) has the molecular formula C19H28FN2O2P and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;3-[fluoro(methyl)phosphoryl]oxy-2,2-dimethylbutane.
| Compound Name | 4-(4-aminophenyl)aniline;3-[fluoro(methyl)phosphoryl]oxy-2,2-dimethylbutane |
|---|---|
| PubChem CID | 174920168 |
| Molecular Formula | C19H28FN2O2P |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-(4-aminophenyl)aniline;3-[fluoro(methyl)phosphoryl]oxy-2,2-dimethylbutane |
| SMILES | CC(OP(C)(=O)F)C(C)(C)C.Nc1ccc(-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2.C7H16FO2P/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-6(7(2,3)4)10-11(5,8)9/h1-8H,13-14H2;6H,1-5H3 |
| InChIKey | POEGUDPCNHXQEB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|