C8H19F2O4P2+ — CID 87088573
fluoro-methoxy-oxophosphanium;3-[fluoro(methyl)phosphoryl]oxy-2,2-dimethylbutane (PubChem CID 87088573) has the molecular formula C8H19F2O4P2+ and a molecular weight of 279.18 g/mol. Its IUPAC name is fluoro-methoxy-oxophosphanium;3-[fluoro(methyl)phosphoryl]oxy-2,2-dimethylbutane.
| Compound Name | fluoro-methoxy-oxophosphanium;3-[fluoro(methyl)phosphoryl]oxy-2,2-dimethylbutane |
|---|---|
| PubChem CID | 87088573 |
| Molecular Formula | C8H19F2O4P2+ |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | fluoro-methoxy-oxophosphanium;3-[fluoro(methyl)phosphoryl]oxy-2,2-dimethylbutane |
| SMILES | CC(OP(C)(=O)F)C(C)(C)C.CO[P+](=O)F |
| InChI | InChI=1S/C7H16FO2P.CH3FO2P/c1-6(7(2,3)4)10-11(5,8)9;1-4-5(2)3/h6H,1-5H3;1H3/q;+1 |
| InChIKey | CNLVLRWYJFQHHL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|