C7H16O2P+ — CID 52947808
[(2R)-3,3-dimethylbutan-2-yl]oxy-methyl-oxophosphanium (PubChem CID 52947808) has the molecular formula C7H16O2P+ and a molecular weight of 163.18 g/mol. Its IUPAC name is [(2R)-3,3-dimethylbutan-2-yl]oxy-methyl-oxophosphanium.
| Compound Name | [(2R)-3,3-dimethylbutan-2-yl]oxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 52947808 |
| Molecular Formula | C7H16O2P+ |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | [(2R)-3,3-dimethylbutan-2-yl]oxy-methyl-oxophosphanium |
| SMILES | C[C@@H](O[P+](C)=O)C(C)(C)C |
| InChI | InChI=1S/C7H16O2P/c1-6(7(2,3)4)9-10(5)8/h6H,1-5H3/q+1/t6-/m1/s1 |
| InChIKey | AYQIEWWYFGQKPK-ZCFIWIBFSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|