About 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid
4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid (PubChem CID 40543814) has the molecular formula C17H26NO6P
and a molecular weight of 371.37 g/mol. Its IUPAC name is 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid |
| PubChem CID | 40543814 |
| Molecular Formula | C17H26NO6P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid |
| SMILES | C[C@@H](O[P@](C)(=O)Oc1ccc(NC(=O)CCC(=O)O)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H26NO6P/c1-12(17(2,3)4)23-25(5,22)24-14-8-6-13(7-9-14)18-15(19)10-11-16(20)21/h6-9,12H,10-11H2,1-5H3,(H,18,19)(H,20,21)/t12-,25+/m1/s1 |
| InChIKey | NWUFPMJLZOWRPY-YDBLSZJJSA-N |
| XLogP | 4.14 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid?
The IUPAC name of 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid (CID 40543814) is 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid?
The canonical SMILES for 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid is C[C@@H](O[P@](C)(=O)Oc1ccc(NC(=O)CCC(=O)O)cc1)C(C)(C)C.
What is the InChIKey of 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid?
The InChIKey is NWUFPMJLZOWRPY-YDBLSZJJSA-N. The full InChI is InChI=1S/C17H26NO6P/c1-12(17(2,3)4)23-25(5,22)24-14-8-6-13(7-9-14)18-15(19)10-11-16(20)21/h6-9,12H,10-11H2,1-5H3,(H,18,19)(H,20,21)/t12-,25+/m1/s1.
What are the key properties of 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid?
4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid has a molecular weight of 371.37 g/mol, XLogP of 4.14, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid is sourced from PubChem (CID 40543814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).