C17H26NO6P — CID 40543816
4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid (PubChem CID 40543816) has the molecular formula C17H26NO6P and a molecular weight of 371.37 g/mol. Its IUPAC name is 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 40543816 |
| Molecular Formula | C17H26NO6P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[4-[[(2R)-3,3-dimethylbutan-2-yl]oxy-methylphosphoryl]oxyanilino]-4-oxobutanoic acid |
| SMILES | C[C@@H](O[P@@](C)(=O)Oc1ccc(NC(=O)CCC(=O)O)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H26NO6P/c1-12(17(2,3)4)23-25(5,22)24-14-8-6-13(7-9-14)18-15(19)10-11-16(20)21/h6-9,12H,10-11H2,1-5H3,(H,18,19)(H,20,21)/t12-,25-/m1/s1 |
| InChIKey | NWUFPMJLZOWRPY-XELLLNAOSA-N |
| XLogP | 4.14 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|