C15H31O4P — CID 15200871
(5S)-5-(diethoxyphosphorylmethyl)-2,2,6-trimethylheptan-3-one (PubChem CID 15200871) has the molecular formula C15H31O4P and a molecular weight of 306.38 g/mol. Its IUPAC name is (5S)-5-(diethoxyphosphorylmethyl)-2,2,6-trimethylheptan-3-one.
| Compound Name | (5S)-5-(diethoxyphosphorylmethyl)-2,2,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 15200871 |
| Molecular Formula | C15H31O4P |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (5S)-5-(diethoxyphosphorylmethyl)-2,2,6-trimethylheptan-3-one |
| SMILES | CCOP(=O)(CC(CC(=O)C(C)(C)C)C(C)C)OCC |
| InChI | InChI=1S/C15H31O4P/c1-8-18-20(17,19-9-2)11-13(12(3)4)10-14(16)15(5,6)7/h12-13H,8-11H2,1-7H3 |
| InChIKey | QZQATBSMFQUNQJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|