C15H30O — CID 159081424
(5S)-5-tert-butyl-2,2,6-trimethyloctan-3-one (PubChem CID 159081424) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is (5S)-5-tert-butyl-2,2,6-trimethyloctan-3-one.
| Compound Name | (5S)-5-tert-butyl-2,2,6-trimethyloctan-3-one |
|---|---|
| PubChem CID | 159081424 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | (5S)-5-tert-butyl-2,2,6-trimethyloctan-3-one |
| SMILES | CCC(C)[C@H](CC(=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H30O/c1-9-11(2)12(14(3,4)5)10-13(16)15(6,7)8/h11-12H,9-10H2,1-8H3/t11?,12-/m0/s1 |
| InChIKey | KAXGKTXSAYVJFV-KIYNQFGBSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |