About 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid
3-ethyl-2-fluoro-2,4-dimethylhexanoic acid (PubChem CID 134225925) has the molecular formula C10H19FO2
and a molecular weight of 190.26 g/mol. Its IUPAC name is 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid |
| PubChem CID | 134225925 |
| Molecular Formula | C10H19FO2 |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid |
| SMILES | CCC(C)C(CC)C(C)(F)C(=O)O |
| InChI | InChI=1S/C10H19FO2/c1-5-7(3)8(6-2)10(4,11)9(12)13/h7-8H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | GNIQFGJEWLNREJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid?
The IUPAC name of 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid (CID 134225925) is 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid.
What is the SMILES notation for 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid?
The canonical SMILES for 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid is CCC(C)C(CC)C(C)(F)C(=O)O.
What is the InChIKey of 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid?
The InChIKey is GNIQFGJEWLNREJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FO2/c1-5-7(3)8(6-2)10(4,11)9(12)13/h7-8H,5-6H2,1-4H3,(H,12,13).
What are the key properties of 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid?
3-ethyl-2-fluoro-2,4-dimethylhexanoic acid has a molecular weight of 190.26 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-fluoro-2,4-dimethylhexanoic acid is sourced from PubChem (CID 134225925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).