2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid

C11H21NO3 — CID 120515956

IUPAC2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid
SMILESCCC(C)C(C)C(=O)NC(C)(C)C(=O)O
InChIInChI=1S/C11H21NO3/c1-6-7(2)8(3)9(13)12-11(4,5)10(14)15/h7-8H,6H2,1-5H3,(H,12,13)(H,14,15)
InChIKeyDOGAISVDEHYNGM-UHFFFAOYSA-N
MW215.29 g/mol
LogP1.65
Rot. Bonds5

About 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid

2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid (PubChem CID 120515956) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid.

Molecular Properties

Compound Name2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid
PubChem CID120515956
Molecular FormulaC11H21NO3
Molecular Weight215.29 g/mol
Exact Mass215.15
IUPAC Name2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid
SMILESCCC(C)C(C)C(=O)NC(C)(C)C(=O)O
InChIInChI=1S/C11H21NO3/c1-6-7(2)8(3)9(13)12-11(4,5)10(14)15/h7-8H,6H2,1-5H3,(H,12,13)(H,14,15)
InChIKeyDOGAISVDEHYNGM-UHFFFAOYSA-N
XLogP1.65
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.29
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid?
The IUPAC name of 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid (CID 120515956) is 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid.
What is the SMILES notation for 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid?
The canonical SMILES for 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid is CCC(C)C(C)C(=O)NC(C)(C)C(=O)O.
What is the InChIKey of 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid?
The InChIKey is DOGAISVDEHYNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-6-7(2)8(3)9(13)12-11(4,5)10(14)15/h7-8H,6H2,1-5H3,(H,12,13)(H,14,15).
What are the key properties of 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid?
2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid has a molecular weight of 215.29 g/mol, XLogP of 1.65, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylpentanoylamino)-2-methylpropanoic acid is sourced from PubChem (CID 120515956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).