C10H21NO3 — CID 142311120
ethane;2-methyl-2-(2-methylpropanoylamino)propanoic acid (PubChem CID 142311120) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is ethane;2-methyl-2-(2-methylpropanoylamino)propanoic acid.
| Compound Name | ethane;2-methyl-2-(2-methylpropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 142311120 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | ethane;2-methyl-2-(2-methylpropanoylamino)propanoic acid |
| SMILES | CC.CC(C)C(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C8H15NO3.C2H6/c1-5(2)6(10)9-8(3,4)7(11)12;1-2/h5H,1-4H3,(H,9,10)(H,11,12);1-2H3 |
| InChIKey | CAHBDAXFXFFPDL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |