C13H22N2O6 — CID 11312683
2-[[3-(2-carboxypropan-2-ylamino)-2,2-dimethyl-3-oxopropanoyl]amino]-2-methylpropanoic acid (PubChem CID 11312683) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[[3-(2-carboxypropan-2-ylamino)-2,2-dimethyl-3-oxopropanoyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[3-(2-carboxypropan-2-ylamino)-2,2-dimethyl-3-oxopropanoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11312683 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[[3-(2-carboxypropan-2-ylamino)-2,2-dimethyl-3-oxopropanoyl]amino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)C(C)(C)C(=O)NC(C)(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H22N2O6/c1-11(2,7(16)14-12(3,4)9(18)19)8(17)15-13(5,6)10(20)21/h1-6H3,(H,14,16)(H,15,17)(H,18,19)(H,20,21) |
| InChIKey | LYAOVKLDTDXMTD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|