C11H22N2O3 — CID 61481256
2-(3,3-dimethylbutylcarbamoylamino)-2-methylpropanoic acid (PubChem CID 61481256) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylcarbamoylamino)-2-methylpropanoic acid.
| Compound Name | 2-(3,3-dimethylbutylcarbamoylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61481256 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-(3,3-dimethylbutylcarbamoylamino)-2-methylpropanoic acid |
| SMILES | CC(C)(C)CCNC(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C11H22N2O3/c1-10(2,3)6-7-12-9(16)13-11(4,5)8(14)15/h6-7H2,1-5H3,(H,14,15)(H2,12,13,16) |
| InChIKey | YAIQYIIMBRHOAE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |