C9H19N3O3 — CID 16784119
2-[2-(dimethylamino)ethylcarbamoylamino]-2-methylpropanoic acid (PubChem CID 16784119) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylcarbamoylamino]-2-methylpropanoic acid.
| Compound Name | 2-[2-(dimethylamino)ethylcarbamoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 16784119 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-[2-(dimethylamino)ethylcarbamoylamino]-2-methylpropanoic acid |
| SMILES | CN(C)CCNC(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C9H19N3O3/c1-9(2,7(13)14)11-8(15)10-5-6-12(3)4/h5-6H2,1-4H3,(H,13,14)(H2,10,11,15) |
| InChIKey | TUYWSFRGODKFGT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |