C11H23ClN2O3 — CID 120500337
ethyl 2-[(3-amino-2-methylbutanoyl)amino]-2-methylpropanoate;hydrochloride (PubChem CID 120500337) has the molecular formula C11H23ClN2O3 and a molecular weight of 266.77 g/mol. Its IUPAC name is ethyl 2-[(3-amino-2-methylbutanoyl)amino]-2-methylpropanoate;hydrochloride.
| Compound Name | ethyl 2-[(3-amino-2-methylbutanoyl)amino]-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 120500337 |
| Molecular Formula | C11H23ClN2O3 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | ethyl 2-[(3-amino-2-methylbutanoyl)amino]-2-methylpropanoate;hydrochloride |
| SMILES | CCOC(=O)C(C)(C)NC(=O)C(C)C(C)N.Cl |
| InChI | InChI=1S/C11H22N2O3.ClH/c1-6-16-10(15)11(4,5)13-9(14)7(2)8(3)12;/h7-8H,6,12H2,1-5H3,(H,13,14);1H |
| InChIKey | NJTMVFUFAYWKHH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |