C11H22O3 — CID 79304533
3-ethyl-2-hydroxy-4-methyl-2-propan-2-ylpentanoic acid (PubChem CID 79304533) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 3-ethyl-2-hydroxy-4-methyl-2-propan-2-ylpentanoic acid.
| Compound Name | 3-ethyl-2-hydroxy-4-methyl-2-propan-2-ylpentanoic acid |
|---|---|
| PubChem CID | 79304533 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 3-ethyl-2-hydroxy-4-methyl-2-propan-2-ylpentanoic acid |
| SMILES | CCC(C(C)C)C(O)(C(=O)O)C(C)C |
| InChI | InChI=1S/C11H22O3/c1-6-9(7(2)3)11(14,8(4)5)10(12)13/h7-9,14H,6H2,1-5H3,(H,12,13) |
| InChIKey | XXHXBBXLBXARJQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |