C14H33O9P3 — CID 10160299
1,1,2-tris(diethoxyphosphoryl)ethane (PubChem CID 10160299) has the molecular formula C14H33O9P3 and a molecular weight of 438.33 g/mol. Its IUPAC name is 1,1,2-tris(diethoxyphosphoryl)ethane.
| Compound Name | 1,1,2-tris(diethoxyphosphoryl)ethane |
|---|---|
| PubChem CID | 10160299 |
| Molecular Formula | C14H33O9P3 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1,1,2-tris(diethoxyphosphoryl)ethane |
| SMILES | CCOP(=O)(CC(P(=O)(OCC)OCC)P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C14H33O9P3/c1-7-18-24(15,19-8-2)13-14(25(16,20-9-3)21-10-4)26(17,22-11-5)23-12-6/h14H,7-13H2,1-6H3 |
| InChIKey | SHROWEIKGGWXKL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|