C11H23NO6P2 — CID 15162590
3,3-bis(diethoxyphosphoryl)propanenitrile (PubChem CID 15162590) has the molecular formula C11H23NO6P2 and a molecular weight of 327.25 g/mol. Its IUPAC name is 3,3-bis(diethoxyphosphoryl)propanenitrile.
| Compound Name | 3,3-bis(diethoxyphosphoryl)propanenitrile |
|---|---|
| PubChem CID | 15162590 |
| Molecular Formula | C11H23NO6P2 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3,3-bis(diethoxyphosphoryl)propanenitrile |
| SMILES | CCOP(=O)(OCC)C(CC#N)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H23NO6P2/c1-5-15-19(13,16-6-2)11(9-10-12)20(14,17-7-3)18-8-4/h11H,5-9H2,1-4H3 |
| InChIKey | XAYOLXWMEAELHD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|