C18H33O4PSi — CID 42600508
tert-butyl-[[4-(diethoxyphosphorylmethyl)phenyl]methoxy]-dimethylsilane (PubChem CID 42600508) has the molecular formula C18H33O4PSi and a molecular weight of 372.52 g/mol. Its IUPAC name is tert-butyl-[[4-(diethoxyphosphorylmethyl)phenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[4-(diethoxyphosphorylmethyl)phenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 42600508 |
| Molecular Formula | C18H33O4PSi |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | tert-butyl-[[4-(diethoxyphosphorylmethyl)phenyl]methoxy]-dimethylsilane |
| SMILES | CCOP(=O)(Cc1ccc(CO[Si](C)(C)C(C)(C)C)cc1)OCC |
| InChI | InChI=1S/C18H33O4PSi/c1-8-20-23(19,21-9-2)15-17-12-10-16(11-13-17)14-22-24(6,7)18(3,4)5/h10-13H,8-9,14-15H2,1-7H3 |
| InChIKey | HBTICVSAKOCIPO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|