C25H49O8P2Si+ — CID 87575124
butane;[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-(diethoxyphosphorylmethyl)phenyl]methoxy-hydroxy-oxophosphanium (PubChem CID 87575124) has the molecular formula C25H49O8P2Si+ and a molecular weight of 567.69 g/mol. Its IUPAC name is butane;[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-(diethoxyphosphorylmethyl)phenyl]methoxy-hydroxy-oxophosphanium.
| Compound Name | butane;[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-(diethoxyphosphorylmethyl)phenyl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87575124 |
| Molecular Formula | C25H49O8P2Si+ |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | butane;[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-(diethoxyphosphorylmethyl)phenyl]methoxy-hydroxy-oxophosphanium |
| SMILES | CCCC.CCOP(=O)(Cc1ccc(CO[P+](=O)O)c(OCCCO[Si](C)(C)C(C)(C)C)c1)OCC |
| InChI | InChI=1S/C21H38O8P2Si.C4H10/c1-8-27-31(24,28-9-2)17-18-11-12-19(16-26-30(22)23)20(15-18)25-13-10-14-29-32(6,7)21(3,4)5;1-3-4-2/h11-12,15H,8-10,13-14,16-17H2,1-7H3;3-4H2,1-2H3/p+1 |
| InChIKey | BLMVJYFWMGSCHV-UHFFFAOYSA-O |
| XLogP | 8.22 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|