About 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene
1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene (PubChem CID 101207069) has the molecular formula C28H46O8P2
and a molecular weight of 572.62 g/mol. Its IUPAC name is 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene.
Molecular Properties
| Compound Name | 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene |
| PubChem CID | 101207069 |
| Molecular Formula | C28H46O8P2 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene |
| SMILES | CCCCOc1ccc(CP(=O)(OCC)OCC)c2c(OCCCC)ccc(CP(=O)(OCC)OCC)c12 |
| InChI | InChI=1S/C28H46O8P2/c1-7-13-19-31-25-17-15-24(22-38(30,35-11-5)36-12-6)28-26(32-20-14-8-2)18-16-23(27(25)28)21-37(29,33-9-3)34-10-4/h15-18H,7-14,19-22H2,1-6H3 |
| InChIKey | GCOIIOJSGCPATH-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene?
The IUPAC name of 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene (CID 101207069) is 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene.
What is the SMILES notation for 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene?
The canonical SMILES for 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene is CCCCOc1ccc(CP(=O)(OCC)OCC)c2c(OCCCC)ccc(CP(=O)(OCC)OCC)c12.
What is the InChIKey of 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene?
The InChIKey is GCOIIOJSGCPATH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H46O8P2/c1-7-13-19-31-25-17-15-24(22-38(30,35-11-5)36-12-6)28-26(32-20-14-8-2)18-16-23(27(25)28)21-37(29,33-9-3)34-10-4/h15-18H,7-14,19-22H2,1-6H3.
What are the key properties of 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene?
1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene has a molecular weight of 572.62 g/mol, XLogP of 8.73, 20 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene is sourced from PubChem (CID 101207069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).