C28H46O8P2 — CID 101207069
1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene (PubChem CID 101207069) has the molecular formula C28H46O8P2 and a molecular weight of 572.62 g/mol. Its IUPAC name is 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene.
| Compound Name | 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene |
|---|---|
| PubChem CID | 101207069 |
| Molecular Formula | C28H46O8P2 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 1,5-dibutoxy-4,8-bis(diethoxyphosphorylmethyl)naphthalene |
| SMILES | CCCCOc1ccc(CP(=O)(OCC)OCC)c2c(OCCCC)ccc(CP(=O)(OCC)OCC)c12 |
| InChI | InChI=1S/C28H46O8P2/c1-7-13-19-31-25-17-15-24(22-38(30,35-11-5)36-12-6)28-26(32-20-14-8-2)18-16-23(27(25)28)21-37(29,33-9-3)34-10-4/h15-18H,7-14,19-22H2,1-6H3 |
| InChIKey | GCOIIOJSGCPATH-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|