C32H58Br2O8P2 — CID 59769793
[2,5-bis(8-bromooctoxy)-4-(diethoxyphosphorylmethyl)phenyl]methyl diethyl phosphite (PubChem CID 59769793) has the molecular formula C32H58Br2O8P2 and a molecular weight of 792.56 g/mol. Its IUPAC name is [2,5-bis(8-bromooctoxy)-4-(diethoxyphosphorylmethyl)phenyl]methyl diethyl phosphite.
| Compound Name | [2,5-bis(8-bromooctoxy)-4-(diethoxyphosphorylmethyl)phenyl]methyl diethyl phosphite |
|---|---|
| PubChem CID | 59769793 |
| Molecular Formula | C32H58Br2O8P2 |
| Molecular Weight | 792.56 g/mol |
| Exact Mass | 790.20 |
| IUPAC Name | [2,5-bis(8-bromooctoxy)-4-(diethoxyphosphorylmethyl)phenyl]methyl diethyl phosphite |
| SMILES | CCOP(OCC)OCc1cc(OCCCCCCCCBr)c(CP(=O)(OCC)OCC)cc1OCCCCCCCCBr |
| InChI | InChI=1S/C32H58Br2O8P2/c1-5-38-43(39-6-2)40-27-29-25-32(37-24-20-16-12-10-14-18-22-34)30(28-44(35,41-7-3)42-8-4)26-31(29)36-23-19-15-11-9-13-17-21-33/h25-26H,5-24,27-28H2,1-4H3 |
| InChIKey | PTCORFTZTYVEEX-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.56 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|